| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | TRANS-2-HYDROXY-BETA-NITROSTYRENE 97 Basic information |
| | TRANS-2-HYDROXY-BETA-NITROSTYRENE 97 Chemical Properties |
| Melting point | 134 °C | | Boiling point | 320.2±17.0 °C(Predicted) | | density | 1.320±0.06 g/cm3(Predicted) | | form | solid | | pka | 8.09±0.30(Predicted) | | InChI | 1S/C8H7NO3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-6,10H/b6-5+ | | InChIKey | PMDYAIGGZBRBFX-AATRIKPKSA-N | | SMILES | [H]\C(=C(\[H])[N+]([O-])=O)c1ccccc1O |
| Hazard Codes | Xn,N | | Risk Statements | 22-36/38-50 | | Safety Statements | 26-36/37-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Eye Irrit. 2
Skin Irrit. 2 |
| | TRANS-2-HYDROXY-BETA-NITROSTYRENE 97 Usage And Synthesis |
| Uses | Reactant for:• ;Michael-acetalization reactions1• ;Organocatalytic stereoselective Baylis-Hillman-type reactions with Hagemann′s esters2• ;Catalyst-free aqueous-mediated conjugate addition reactions3 | | Uses | Reactant for:
- Michael-acetalization reactions
- Organocatalytic stereoselective Baylis-Hillman-type reactions with Hagemann′s esters
- Catalyst-free aqueous-mediated conjugate addition reactions
|
| | TRANS-2-HYDROXY-BETA-NITROSTYRENE 97 Preparation Products And Raw materials |
|