Calix[4]arene manufacturers
- Calix[4]arene
-
- $1.00 / 1g
-
2020-01-10
- CAS:74568-07-3
- Min. Order: 1g
- Purity: 99.0%
- Supply Ability: 100kg
|
| | Calix[4]arene Basic information |
| | Calix[4]arene Chemical Properties |
| Melting point | 310-314 °C | | Boiling point | 500.52°C (rough estimate) | | density | 1.1077 (rough estimate) | | refractive index | 1.6400 (estimate) | | storage temp. | 2-8°C, stored under nitrogen | | solubility | Soluble in chloroform. | | pka | 9.38±0.20(Predicted) | | form | Crystalline Powder | | color | Off-white to light beige | | BRN | 3574428 | | InChI | InChI=1S/C28H24O4/c29-25-17-5-1-6-18(25)14-20-8-3-10-22(27(20)31)16-24-12-4-11-23(28(24)32)15-21-9-2-7-19(13-17)26(21)30/h1-12,29-32H,13-16H2 | | InChIKey | YPNHVQZZPXPQOS-UHFFFAOYSA-N | | SMILES | C12=C(O)C(=CC=C1)CC1=C(O)C(=CC=C1)CC1=C(O)C(=CC=C1)CC1=C(O)C(=CC=C1)C2 |
| | Calix[4]arene Usage And Synthesis |
| Chemical Properties | off-white to light beige crystalline powder | | Uses | Functionalized calix[4]arenes can bind DNA and induce cell transfection. Calixarenes lend themselves well to many applications because of the multiplicity of options for such structural elaboration such as in electrochemical sensors, optical sensors, chiral recognition devices, |
| | Calix[4]arene Preparation Products And Raw materials |
|