|
|
| | Z--HOMOALA-OH Basic information |
| Product Name: | Z--HOMOALA-OH | | Synonyms: | (S)-3-(Cbz-amino)butyric Acid;Z-L-3-Abu-OH;z-β-homoala-oh;(S)-3-(Z-amino)butyric acid, Z-L-β-Homoalanine;(S)-3-(((benzyloxy)carbonyl)aMino)butanoic acid;(S)-3-(CBZ-AMINO)BUTANOIC ACID;Butanoic acid, 3-[[(phenylmethoxy)carbonyl]amino]-, (3S)-;(S)-3-benzyloxycarbonylaminobutyric acid | | CAS: | 83509-88-0 | | MF: | C12H15NO4 | | MW: | 237.25 | | EINECS: | | | Product Categories: | | | Mol File: | 83509-88-0.mol |  |
| | Z--HOMOALA-OH Chemical Properties |
| Melting point | 105-107 °C(Solv: ethyl ether (60-29-7)) | | Boiling point | 435.6±38.0 °C(Predicted) | | density | 1.213±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 4.42±0.10(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | -19.2° (C= 0.010104 g/100ml,CHCL3) | | Major Application | peptide synthesis | | InChI | 1S/C12H15NO4/c1-9(7-11(14)15)13-12(16)17-8-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,13,16)(H,14,15)/t9-/m0/s1 | | InChIKey | HYWJKPFAIAWVHP-VIFPVBQESA-N | | SMILES | C[C@@H](CC(O)=O)NC(=O)OCc1ccccc1 |
| WGK Germany | 3 | | F | 10 | | Storage Class | 13 - Non Combustible Solids |
| | Z--HOMOALA-OH Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Z--HOMOALA-OH Preparation Products And Raw materials |
|