| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:1-(trans-4-Hexylcyclohexyl)-4-isothiocyanatobenzene CAS:92444-14-9 Purity:liquid crystal (nematic), 99% Package:1G Remarks:366854-1G
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:1-(trans-4-Hexylcyclohexyl)-4-isothiocyanatobenzene liquid crystal (nematic), 99% CAS:92444-14-9 Purity:99% Package:1g Remarks:NULL
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:1-(trans-4-Hexylcyclohexyl)-4-isothiocyanatobenzene CAS:92444-14-9
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
Product Name:1-(trans-4-Hexylcyclohexyl)-4-isothiocyanatobenzene CAS:92444-14-9
|
|
| | 1-(TRANS-4-HEXYLCYCLOHEXYL)-4-ISOTHIO- Basic information |
| | 1-(TRANS-4-HEXYLCYCLOHEXYL)-4-ISOTHIO- Chemical Properties |
| Melting point | 12.6 °C | | Boiling point | 418.5±24.0 °C(Predicted) | | density | 0.977 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.532(lit.) | | Fp | 113 °C | | form | liquid crystal (nematic) | | InChI | 1S/C19H27NS/c1-2-3-4-5-6-16-7-9-17(10-8-16)18-11-13-19(14-12-18)20-15-21/h11-14,16-17H,2-10H2,1H3/t16-,17- | | InChIKey | STLICVZWECVJDT-QAQDUYKDSA-N | | SMILES | CCCCCC[C@H]1CC[C@@H](CC1)c2ccc(cc2)N=C=S |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 23-26-28-36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-(TRANS-4-HEXYLCYCLOHEXYL)-4-ISOTHIO- Usage And Synthesis |
| | 1-(TRANS-4-HEXYLCYCLOHEXYL)-4-ISOTHIO- Preparation Products And Raw materials |
|