|
|
| | Dichlorotetrakis[2-(2-pyridyl)phenyl]diiridiuM(III) Basic information |
| | Dichlorotetrakis[2-(2-pyridyl)phenyl]diiridiuM(III) Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | solubility | Dichloromethane (Slightly), Pyridine (Slightly) | | form | powder to crystal | | color | Light orange to Yellow to Green | | InChI | 1S/4C11H9N.2ClH.2Ir/c4*1-2-6-10(7-3-1)11-8-4-5-9-12-11;;;;/h4*1-9H;2*1H;;/q;;;;;;2*+1/p-2 | | InChIKey | NARZJSRZFGZBIZ-UHFFFAOYSA-L | | SMILES | Cl[Ir](c1ccccc1-c2ccccn2)c3ccccc3-c4ccccn4.Cl[Ir](c5ccccc5-c6ccccn6)c7ccccc7-c8ccccn8 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Dichlorotetrakis[2-(2-pyridyl)phenyl]diiridiuM(III) Usage And Synthesis |
| Uses | Dichlorotetrakis[2-(2-pyridyl)phenyl]diiridium(III) is useful in catalysis and OLEDs. | | Uses | Dichlorotetrakis(2-(2-pyridinyl)phenyl)diiridium(III) is used in the synthesis of electrochemical cells and luminescent compounds. | | Uses | Precursor for several OLED Iridium compounds. Has some use as a catalyst and in OLEDs. | | reaction suitability | core: iridium reaction type: Photocatalysis reagent type: catalyst |
| | Dichlorotetrakis[2-(2-pyridyl)phenyl]diiridiuM(III) Preparation Products And Raw materials |
|