| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:Metaraminol Impurity 1
CAS:639070-81-8
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Nanjing XiZe Biotechnology CO., Ltd.
|
| Tel: |
025-66023220 15250997978 |
| Email: |
1511893459@qq.com |
| Products Intro: |
Product Name:Metaraminol Impurity 1
CAS:639070-81-8
Purity:95% HPLC Package:10mg;25mg;50mg;100mg;250mg;500mg;1g
|
Metaraminol Bitartrate Impurity 1 manufacturers
|
| | Metaraminol Bitartrate Impurity 1 Basic information |
| Product Name: | Metaraminol Bitartrate Impurity 1 | | Synonyms: | Metaraminol Impurity 1;Metaraminol Bitartrate Impurity 1;2-Propanone, 1-hydroxy-1-(3-hydroxyphenyl)-, (1S)-;(S)-1-hydroxy-1-(3-hydroxyphenyl)propan-2-one;Metaraminol Impurity | | CAS: | 639070-81-8 | | MF: | C9H10O3 | | MW: | 166.17 | | EINECS: | | | Product Categories: | | | Mol File: | 639070-81-8.mol |  |
| | Metaraminol Bitartrate Impurity 1 Chemical Properties |
| InChI | InChI=1S/C9H10O3/c1-6(10)9(12)7-3-2-4-8(11)5-7/h2-5,9,11-12H,1H3/t9-/m1/s1 | | InChIKey | DQKWSNSMBHOHLP-SECBINFHSA-N | | SMILES | [C@H](O)(C1=CC=CC(O)=C1)C(=O)C |
| | Metaraminol Bitartrate Impurity 1 Usage And Synthesis |
| | Metaraminol Bitartrate Impurity 1 Preparation Products And Raw materials |
|