MF-095 manufacturers
- MF-095
-
- $2800.00
-
2026-07-15
- CAS:2241021-89-4
- Purity:
- Supply Ability: 10g
|
| Product Name: | MF-095 | | Synonyms: | MF-095;Benzenepropanamide, α-[(cyclopropylcarbonyl)amino]-N-[5-[[(1,1-dimethylethyl)amino]sulfonyl]-1-naphthalenyl]-, (αS)-;(αS)-α-[(Cyclopropylcarbonyl)amino]-N-[5-[[(1,1-dimethylethyl)amino]sulfonyl]-1-naphthalenyl]benzenepropanamide | | CAS: | 2241021-89-4 | | MF: | C27H31N3O4S | | MW: | 493.62 | | EINECS: | | | Product Categories: | | | Mol File: | 2241021-89-4.mol |  |
| | MF-095 Chemical Properties |
| density | 1.290±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 2mg/mL, clear | | pka | 11.96±0.50(Predicted) | | form | powder | | color | white to beige | | InChIKey | JSNVUWHDPLJARW-QHCPKHFHSA-N | | SMILES | [S](=O)(=O)(NC(C)(C)C)c1c2c(c(ccc2)NC(=O)[C@@H](NC(=O)C4CC4)Cc3ccccc3)ccc1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | MF-095 Usage And Synthesis |
| Description | MF-095 is a control probe for MF-094, which is a potent inhibitor of ubiquitin specific protease 30. | | Uses | MF-095 is a USP30 inhibitor. MF-095 promotes mitochondrial autophagy. MF-095 can be used in neurological disease-related research[1]. |
| | MF-095 Preparation Products And Raw materials |
|