|
|
| | 3-Pyridazinecarboxylic acid, 5,6-dichloro-, methyl ester Basic information |
| | 3-Pyridazinecarboxylic acid, 5,6-dichloro-, methyl ester Chemical Properties |
| Boiling point | 355.7±37.0 °C(Predicted) | | density | 1.503±0.06 g/cm3(Predicted) | | pka | -2.94±0.10(Predicted) | | InChI | InChI=1S/C6H4Cl2N2O2/c1-12-6(11)4-2-3(7)5(8)10-9-4/h2H,1H3 | | InChIKey | VPTUKZREOXVXTE-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)=NN=C(Cl)C(Cl)=C1 |
| | 3-Pyridazinecarboxylic acid, 5,6-dichloro-, methyl ester Usage And Synthesis |
| Uses | Methyl 5,6-Dichloropyridazine-3-carboxylate was a useful reagent in the study of inhibitors for treatment of HIV infections and AIDS. |
| | 3-Pyridazinecarboxylic acid, 5,6-dichloro-, methyl ester Preparation Products And Raw materials |
|