(R)-α-[N-(t-butoxycarbonylmethyl) carbamoyl]benzylamine manufacturers
|
| | (R)-α-[N-(t-butoxycarbonylmethyl) carbamoyl]benzylamine Basic information |
| Product Name: | (R)-α-[N-(t-butoxycarbonylmethyl) carbamoyl]benzylamine | | Synonyms: | (R)-α-[N-(t-butoxycarbonylmethyl) carbamoyl]benzylamine;(2R)-2-Phenylglycyl-glycine 1,1-Dimethylethyl Ester;Glycine, (2R)-2-phenylglycyl-, 1,1-dimethylethyl ester (9CI);tert-Butyl (R)-(2-amino-2-phenylacetyl)glycinate;(R)-a-[N-(t-butoxycarbonylmethyl) carbamoy]benzylamine;Elobixibat Impurity 1;R)-a-[N-(t-butoxycarbonylmethyl)carbamoyllbenzylamine;(R)-tert-butyl 2-(2-amino-2-phenylacetamido)acetate | | CAS: | 439088-74-1 | | MF: | C14H20N2O3 | | MW: | 264.32 | | EINECS: | | | Product Categories: | | | Mol File: | 439088-74-1.mol | ![(R)-α-[N-(t-butoxycarbonylmethyl) carbamoyl]benzylamine Structure](CAS/20200611/GIF/439088-74-1.gif) |
| | (R)-α-[N-(t-butoxycarbonylmethyl) carbamoyl]benzylamine Chemical Properties |
| Boiling point | 423.1±40.0 °C(Predicted) | | density | 1.123±0.06 g/cm3(Predicted) | | solubility | Ethanol; Dichloromethane; | | form | Oil | | pka | 13.16±0.46(Predicted) | | color | Clear Colorless | | InChI | InChI=1S/C14H20N2O3/c1-14(2,3)19-11(17)9-16-13(18)12(15)10-7-5-4-6-8-10/h4-8,12H,9,15H2,1-3H3,(H,16,18)/t12-/m1/s1 | | InChIKey | ZCERGRXTTGLHFZ-GFCCVEGCSA-N | | SMILES | C(OC(C)(C)C)(=O)CNC(=O)[C@@H](C1=CC=CC=C1)N |
| | (R)-α-[N-(t-butoxycarbonylmethyl) carbamoyl]benzylamine Usage And Synthesis |
| Uses | (2R)-2-Phenylglycyl-glycine 1,1-Dimethylethyl Ester is an intermediate used in the synthesis of Piperazinedione-carbonyl D-Phenylglycyl-glycine (P480165), which is an impurity of Piperacillin (P479950), a broad spectrum semi-synthetic antibiotic related to Penicillin. |
| | (R)-α-[N-(t-butoxycarbonylmethyl) carbamoyl]benzylamine Preparation Products And Raw materials |
|