| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Dichlorobis[2-(di-I-propylphosphino)ethylamine]ruthenium (II), min Basic information | | Reaction |
| | Dichlorobis[2-(di-I-propylphosphino)ethylamine]ruthenium (II), min Chemical Properties |
| Melting point | 154-157°C | | form | Powder | | color | orange | | InChI | 1S/2C8H20NP.2ClH.Ru/c2*1-7(2)10(6-5-9)8(3)4;;;/h2*7-8H,5-6,9H2,1-4H3;2*1H;/q;;;;+2/p-2 | | InChIKey | HINVYXXIKGEKJI-UHFFFAOYSA-L | | SMILES | Cl[Ru]Cl.CC(C)P(CCN)C(C)C.CC(C)P(CCN)C(C)C |
| WGK Germany | 3 | | HS Code | 28439090 | | Storage Class | 11 - Combustible Solids |
| | Dichlorobis[2-(di-I-propylphosphino)ethylamine]ruthenium (II), min Usage And Synthesis |
| Reaction | Exceptionally active catalyst for the hydrogenation of ketones and imines under mild conditions. Selective hydrogenation of C = O bonds over C = C bonds.
| | reaction suitability | core: ruthenium
reagent type: catalyst |
| | Dichlorobis[2-(di-I-propylphosphino)ethylamine]ruthenium (II), min Preparation Products And Raw materials |
|