|
|
| | 3-BROMO-2-FLUORONITROBENZENE Basic information |
| Product Name: | 3-BROMO-2-FLUORONITROBENZENE | | Synonyms: | 3-Bromo-2-fluoronitrobenzene 98%;3-Bromo-2-fluoronitrobenzene98%;1-Bromo-2-fluoro-3-nitrobenzene;3-BROMO-2-FLUORONITROBENZENE;2-Fluoro-3-bromonitrobenzene;2-Fluoro-3-broMonitrobenzene3-BroMo-2-fluoronitrobenzene;Benzene, 1-bromo-2-fluoro-3-nitro-;3-BROMO-2-FLUORONITROBENZENE ISO 9001：2015 REACH | | CAS: | 58534-94-4 | | MF: | C6H3BrFNO2 | | MW: | 220 | | EINECS: | | | Product Categories: | blocks;Bromides;NitroCompounds;Pyridines | | Mol File: | 58534-94-4.mol |  |
| | 3-BROMO-2-FLUORONITROBENZENE Chemical Properties |
| Melting point | 29-31°C | | Boiling point | 259.1±20.0 °C(Predicted) | | density | 1.808±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | fused solid | | color | Clear, red/brown | | InChI | InChI=1S/C6H3BrFNO2/c7-4-2-1-3-5(6(4)8)9(10)11/h1-3H | | InChIKey | MWYFDHRLYOKUMH-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=CC([N+]([O-])=O)=C1F |
| | 3-BROMO-2-FLUORONITROBENZENE Usage And Synthesis |
| Chemical Properties | Pale-yellow to yellow or red-brown solid or liquid. | | Uses | 3-Bromo-2-fluoronitrobenzene can be used in copper reduction reactions. It can also be used as organic electrophosphorescent material and organic electroluminescent elements and electronic devices. |
| | 3-BROMO-2-FLUORONITROBENZENE Preparation Products And Raw materials |
|