|
|
| | 3-Cyano-4,6-dimethyl-2-hydroxypyridine Basic information |
| | 3-Cyano-4,6-dimethyl-2-hydroxypyridine Chemical Properties |
| Melting point | 285-287 °C (lit.) | | Boiling point | 268.75°C (rough estimate) | | density | 1.1828 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | 9.06±0.10(Predicted) | | color | White to Light yellow to Light orange | | BRN | 130992 | | InChI | InChI=1S/C8H8N2O/c1-5-3-6(2)10-8(11)7(5)4-9/h3H,1-2H3,(H,10,11) | | InChIKey | OCYMJCILWYHKAU-UHFFFAOYSA-N | | SMILES | C1(=O)NC(C)=CC(C)=C1C#N | | CAS DataBase Reference | 769-28-8(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | 3276 | | WGK Germany | 3 | | RTECS | QT3046500 | | HazardClass | IRRITANT | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Cyano-4,6-dimethyl-2-hydroxypyridine Usage And Synthesis |
| Chemical Properties | WHITE FINE CRYSTALS OR CRYSTALLINE POWDER | | Definition | ChEBI: 2-Hydroxy-4,6-dimethylnicotinonitrile is a member of pyridines and a nitrile. | | Synthesis Reference(s) | Journal of the American Chemical Society, 73, p. 2616, 1951 DOI: 10.1021/ja01150a057 |
| | 3-Cyano-4,6-dimethyl-2-hydroxypyridine Preparation Products And Raw materials |
|