|
|
| | Methacrylatoethyl trimethyl ammonium chloride Basic information |
| | Methacrylatoethyl trimethyl ammonium chloride Chemical Properties |
| Melting point | -25°C | | Boiling point | >100°C | | density | 1.105 g/mL at 25 °C | | refractive index | n20/D 1.469 | | Fp | >100°C | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Water Solubility | It is soluble in water. | | BRN | 8168395 | | Stability: | Stable. Incompatible with steel, rust, reducing agents, heavy metal salts, carbon dioxide, oxidizing agents. May be prone to hazardous spontaneous polymerisation. | | InChI | 1S/C9H18NO2.ClH/c1-8(2)9(11)12-7-6-10(3,4)5;/h1,6-7H2,2-5H3;1H/q+1;/p-1 | | InChIKey | RRHXZLALVWBDKH-UHFFFAOYSA-M | | SMILES | [Cl-].CC(=C)C(=O)OCC[N+](C)(C)C | | LogP | -2.49 at 20℃ and pH7 | | CAS DataBase Reference | 5039-78-1(CAS DataBase Reference) | | EPA Substance Registry System | Ethanaminium, N,N,N-trimethyl-2-[(2-methyl-1-oxo-2-propenyl)oxy]-, chloride (5039-78-1) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/38-43-36 | | Safety Statements | 26-36-36/37-24/25 | | WGK Germany | 1 | | TSCA | TSCA listed | | HS Code | 29239000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Sens. 1 |
| | Methacrylatoethyl trimethyl ammonium chloride Usage And Synthesis |
| Chemical Properties | aqueous solution | | Uses | 2-(Methacryloyloxy)ethyltrimethylammonium chloride is a zirconium, aluminum and organic surface treated multipurpose rutile titanium dioxide pigment, it has narrow-size material distribution, good whiteness and high weather resistance. It is widely used in coating, plastics, paints, rubber and ink production, leather, cosmetics, soaps, plastics and in paper industry. |
| | Methacrylatoethyl trimethyl ammonium chloride Preparation Products And Raw materials |
|