| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:FLUBENDAZOLE CAS:37893-02-0
|
| Company Name: |
Chemwill Asia Co.,Ltd.
|
| Tel: |
86-21-51086038 |
| Email: |
chemwill_asia@126.com |
| Products Intro: |
CAS:37893-02-0 Purity:99% Package:5KG;1KG;25KG PRICE quotation Remarks:Factory stock, quality assurance, price concessions
|
| Company Name: |
3B Pharmachem (Wuhan) International Co.,Ltd.
|
| Tel: |
821-50328103-801 18930552037 |
| Email: |
3bsc@sina.com |
| Products Intro: |
Product Name:FLUBENDAZOLE CAS:37893-02-0 Purity:99% HPLC Package:1Mg ; 5Mg;10Mg ;100Mg;250Mg ;500Mg ;1g;2.5g ;5g ;10g
|
|
| | FLUBENDAZOLE Basic information |
| | FLUBENDAZOLE Chemical Properties |
| Melting point | 260°C | | Boiling point | 313.2±52.0 °C(Predicted) | | density | 1.4917 (estimate) | | Fp | >100 °C | | storage temp. | 0-6°C | | pka | -9.17±0.20(Predicted) | | Merck | 13,4145 | | Henry's Law Constant | 2.3×1010 mol/(m3Pa) at 25℃, MacBean (2012) | | Major Application | agriculture environmental | | InChI | 1S/C17H10F6N4S/c18-16(19,20)25-13-14(26-17(21,22)23)28-15(24-11-7-3-1-4-8-11)27(13)12-9-5-2-6-10-12/h1-10H/b24-15-,25-13+,26-14- | | InChIKey | IZFZCMFMJKDHJZ-BANPTERESA-N | | SMILES | FC(F)(F)/N=C1S\C(=N/c2ccccc2)N(c3ccccc3)C\1=N\C(F)(F)F | | CAS DataBase Reference | 37893-02-0(CAS DataBase Reference) | | EPA Substance Registry System | Flubenzimine (37893-02-0) |
| Hazard Codes | Xi,N | | Risk Statements | 36-50/53 | | Safety Statements | 26-60-61 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 3 | | RTECS | CY1202500 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Inhalation Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 | | Toxicity | LD50 orally in rats: 3750 mg/kg (Bluett, Wainwright) |
| | FLUBENDAZOLE Usage And Synthesis |
| Chemical Properties | Crystalline Solid | | Uses | Acaricide. | | Uses | An anthelmintic |
| | FLUBENDAZOLE Preparation Products And Raw materials |
|