|
|
| | IODOFENPHOS Basic information |
| | IODOFENPHOS Chemical Properties |
| Melting point | 72-73° (Beriger); mp 75° (Haddow) | | Boiling point | 30.1°C | | density | 2.0 g/cm3 | | storage temp. | APPROX 4°C | | form | solid | | Water Solubility | 0.1mg/L(20 ºC) | | Merck | 13,5054 | | Major Application | agriculture environmental | | InChI | 1S/C8H8Cl2IO3PS/c1-12-15(16,13-2)14-8-4-5(9)7(11)3-6(8)10/h3-4H,1-2H3 | | InChIKey | LFVLUOAHQIVABZ-UHFFFAOYSA-N | | SMILES | COP(=S)(OC)Oc1cc(Cl)c(I)cc1Cl | | EPA Substance Registry System | Jodfenphos (18181-70-9) |
| Hazard Codes | Xn,N | | Risk Statements | 21-50/53 | | Safety Statements | 36/37-60-61 | | RIDADR | UN2811 6.1/PG 3 | | WGK Germany | WGK 3 | | RTECS | TF0175000 | | HS Code | 29201900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Aquatic Acute 1 | | Hazardous Substances Data | 18181-70-9(Hazardous Substances Data) | | Toxicity | LD50 in rats, female mice (mg/kg): 2100, >10000, orally (Haddow, Marks) |
| | IODOFENPHOS Usage And Synthesis |
| Uses | Insecticide. | | Uses | Jodfenphos is lavendustin A. | | Definition | ChEBI: Iodofenphos is an organic thiophosphate. |
| | IODOFENPHOS Preparation Products And Raw materials |
|