| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-(2-Isopropoxy-phenoxy)-piperidine Basic information |
| | 4-(2-Isopropoxy-phenoxy)-piperidine Chemical Properties |
| Boiling point | 332.2±32.0 °C(Predicted) | | density | 1.025±0.06 g/cm3(Predicted) | | pka | 9.74±0.10(Predicted) | | form | powder | | InChI | 1S/C14H21NO2/c1-11(2)16-13-5-3-4-6-14(13)17-12-7-9-15-10-8-12/h3-6,11-12,15H,7-10H2,1-2H3 | | InChIKey | SZKHIYBVZBJFHT-UHFFFAOYSA-N | | SMILES | CC(C)OC1=CC=CC=C1OC2CCNCC2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | 4-(2-Isopropoxy-phenoxy)-piperidine Usage And Synthesis |
| | 4-(2-Isopropoxy-phenoxy)-piperidine Preparation Products And Raw materials |
|