ALUMINUM TERT-BUTOXIDE manufacturers
- ALUMINUM TERT-BUTOXIDE)
-
- $1.00 / 1KG
-
2020-01-13
- CAS:556-91-2
- Min. Order: 1KG
- Purity: 98%-99.9%
- Supply Ability: 200kg
|
| | ALUMINUM TERT-BUTOXIDE Basic information |
| | ALUMINUM TERT-BUTOXIDE Chemical Properties |
| Melting point | 241°C | | Boiling point | 156°C 2mm | | density | 1,0251 g/cm3 | | Fp | >65°C | | solubility | Very soluble in organic solvents like alcohols, benzene, toluene and xylene. | | form | Powder | | color | White to Gray | | Sensitive | Moisture Sensitive | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | Merck | 14,333 | | BRN | 4148229 | | Stability: | Stable, but air and moisture sensitive. Incompatible with acids, strong oxidizing agents. Highly flammable. | | InChI | 1S/3C4H9O.Al/c3*1-4(2,3)5;/h3*1-3H3;/q3*-1;+3 | | InChIKey | MDDPTCUZZASZIQ-UHFFFAOYSA-N | | SMILES | CC(C)(C)O[Al](OC(C)(C)C)OC(C)(C)C | | CAS DataBase Reference | 556-91-2(CAS DataBase Reference) | | EPA Substance Registry System | 2-Propanol, 2-methyl-, aluminum salt (556-91-2) |
| Hazard Codes | F,C | | Risk Statements | 11-34 | | Safety Statements | 8-16-26-36/37/39-45 | | RIDADR | UN 2925 4.1/PG 2 | | WGK Germany | 3 | | F | 8-21 | | TSCA | TSCA listed | | HazardClass | 4.1 | | PackingGroup | III | | HS Code | 29051990 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Flam. Sol. 1 Skin Corr. 1B |
| | ALUMINUM TERT-BUTOXIDE Usage And Synthesis |
| Chemical Properties | slightly yellow crystalline powder | | Uses | Reagent for oxidation of alcohols to ketones; in dealcoholation of orthoesters. | | Uses | Aluminum tert-butoxide is utilized as a reagent in the Oppenauer oxidation of alcohols to ketones. It is also used in Meerwein-Ponndorf-Verley reduction of ketones. It is actively involved in the preparation of 1,1,2-triethoxyethene by reacting with 1,1,2,2-tetraethoxyethane followed by the elimination of alcohol. | | reaction suitability | core: aluminum | | Purification Methods | Crystallise it from *C6H6 and it sublimes it at 180o. [McElvain & Davie J Am Chem Soc 73 1400 1951, Beilstein 1 IV 1612.] |
| | ALUMINUM TERT-BUTOXIDE Preparation Products And Raw materials |
|