|
|
| | R-(-)-Fluoxetine hydrochloride Basic information |
| | R-(-)-Fluoxetine hydrochloride Chemical Properties |
| Melting point | 126-129°C | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | H2O: 20 mg/mL, soluble | | form | solid | | color | white | | Water Solubility | H2O: soluble >10mg/mL | | InChI | 1S/C17H18F3NO.ClH/c1-21-12-11-16(13-5-3-2-4-6-13)22-15-9-7-14(8-10-15)17(18,19)20;/h2-10,16,21H,11-12H2,1H3;1H/t16-;/m1./s1 | | InChIKey | GIYXAJPCNFJEHY-PKLMIRHRSA-N | | SMILES | Cl[H].CNCC[C@@H](Oc1ccc(cc1)C(F)(F)F)c2ccccc2 | | CAS DataBase Reference | 114247-09-5(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-38-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 |
| | R-(-)-Fluoxetine hydrochloride Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | As a selective serotonin reuptake inhibitor (SSRI), R-(-)-Fluoxetine hydrochloride can be used as an antidepressant. | | Definition | ChEBI: A hydrochloride obtained by reaction of (R)-fluoxetine with one equivalent of hydrochloric acid. | | Biological Activity | Fluoxetine exhibits anti-depressant activity by increasing the serotonin levels in the neuron synaptic space. It also exhibits therapeutic effects against depression and other mood disorders.', 'Selective serotonin reuptake inhibitor. |
| | R-(-)-Fluoxetine hydrochloride Preparation Products And Raw materials |
|