|
|
| | 2-METHYL-6-NITROBENZOIC ANHYDRIDE Basic information |
| | 2-METHYL-6-NITROBENZOIC ANHYDRIDE Chemical Properties |
| Melting point | 173-177 °C | | Boiling point | 559.4±50.0 °C(Predicted) | | density | 1.416±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | very faint turbidity in hot Toluene | | form | powder to crystal | | color | White to Yellow to Orange | | InChI | InChI=1S/C16H12N2O7/c1-9-5-3-7-11(17(21)22)13(9)15(19)25-16(20)14-10(2)6-4-8-12(14)18(23)24/h3-8H,1-2H3 | | InChIKey | YEKPNMQQSPHKBP-UHFFFAOYSA-N | | SMILES | C(C1C(=CC=CC=1N(=O)=O)C)(=O)OC(C1C(=CC=CC=1N(=O)=O)C)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-METHYL-6-NITROBENZOIC ANHYDRIDE Usage And Synthesis |
| Uses | 2-Methyl-6-nitrobenzoic anhydride can be used:
- As a versatile lactonization reagent applicable in the preparation of varieties of macrolide natural products and lactones.
- As a reaction promoter in the synthesis of carboxamide derivatives by using corresponding amines and carboxylic acids.
- In the total synthesis of GRP78 inhibitor prunustatin A, antifungal compound (3R,16E,20E,23R)-(?)-eushearilide and an antiobestic drug tetrahydrolipstatin.
| | General Description | 2-Methyl-6-nitrobenzoic anhydride is a reagent employed as a coupling promoter in the synthesis of amides, lactones, esters, and peptides. |
| | 2-METHYL-6-NITROBENZOIC ANHYDRIDE Preparation Products And Raw materials |
|