|
|
| | Ethyl N-benzoyl-L-tyrosinate Basic information |
| | Ethyl N-benzoyl-L-tyrosinate Chemical Properties |
| Melting point | 118-121 °C(lit.) | | alpha | -24 º (c=1, EtOH) | | Boiling point | 453.15°C (rough estimate) | | density | 1.2389 (rough estimate) | | refractive index | -29 ° (C=1, EtOH) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | almost transparency in Methanol | | pka | 9.75±0.15(Predicted) | | form | Powder | | color | White to slightly yellow | | Optical Rotation | [α]20/D 26±3°, c = 1% in ethanol | | BRN | 2223819 | | InChI | 1S/C18H19NO4/c1-2-23-18(22)16(12-13-8-10-15(20)11-9-13)19-17(21)14-6-4-3-5-7-14/h3-11,16,20H,2,12H2,1H3,(H,19,21)/t16-/m0/s1 | | InChIKey | SRLROPAFMUDDRC-INIZCTEOSA-N | | SMILES | CCOC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)c2ccccc2 | | CAS DataBase Reference | 3483-82-7(CAS DataBase Reference) | | EPA Substance Registry System | L-Tyrosine, N-benzoyl-, ethyl ester (3483-82-7) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | Ethyl N-benzoyl-L-tyrosinate Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | N-Benzoyl-L-tyrosine ethyl ester is a synthetic substrate used to study IMER systems. | | Definition | ChEBI: An L-tyrosine derivative that is the ethyl ester of N-benzoyltyrosine. |
| | Ethyl N-benzoyl-L-tyrosinate Preparation Products And Raw materials |
|