|
|
| | 2-(4-FLUOROBENZOYL)BENZOIC ACID Basic information |
| | 2-(4-FLUOROBENZOYL)BENZOIC ACID Chemical Properties |
| Melting point | 138-140 °C (lit.) | | form | solid | | InChI | 1S/C14H9FO3/c15-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)14(17)18/h1-8H,(H,17,18) | | InChIKey | FJAZVXUPZQSZKI-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccccc1C(=O)c2ccc(F)cc2 | | CAS DataBase Reference | 7649-92-5(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2918300090 | | Storage Class | 11 - Combustible Solids |
| | 2-(4-FLUOROBENZOYL)BENZOIC ACID Usage And Synthesis |
| Uses | 2-(4-Fluorobenzoyl)benzoic acid was used to prepare starting material for the synthesis of 9-fluoro-7H-benz(de)anthracene-7-one. It was used as starting reagent for the synthesis of Heparan sulfate glycosaminoglycans (HSGAG)-mimetic compounds. | | General Description | 2-(4-Fluorobenzoyl)benzoic acid on nitration with fuming HNO3 yields 2-(4-fluoro-3-nitrobenzoyl)benzoic acid. |
| | 2-(4-FLUOROBENZOYL)BENZOIC ACID Preparation Products And Raw materials |
|