- 1,4-Dioxane-2,5-dione
-
- $400.00
-
2026-09-02
- CAS:502-97-6
- Min. Order: 1KG
- Purity: 99% HPLC
- Supply Ability: 2000 ton/year
|
| | 1,4-Dioxane-2,5-dione Basic information |
| Product Name: | 1,4-Dioxane-2,5-dione | | Synonyms: | p-Dioxane-2,5-dione;1,4-DIOXAN-2,5-DIONE;1,4-DIOXANE-2,5-DIONE;PURASORB(R) G;1,4-Dioxane-2,5-dione,97%;1,4-DIOXANE-2,5-DIONE(GLYCOLIDE);1,4-DIOXANE-2,3-DIOL;GLYCOLIDE USP | | CAS: | 502-97-6 | | MF: | C4H4O4 | | MW: | 116.07 | | EINECS: | 207-954-9 | | Product Categories: | PLGA | | Mol File: | 502-97-6.mol |  |
| | 1,4-Dioxane-2,5-dione Chemical Properties |
| Melting point | 81-83°C | | Boiling point | 130°C(lit.) | | density | 1.1315 (rough estimate) | | refractive index | 1.4500 (estimate) | | storage temp. | -20°C | | solubility | Dichloromethane (Slightly), DMSO (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | Cosmetics Ingredients Functions | HUMECTANT
SKIN CONDITIONING | | InChI | InChI=1S/C4H4O4/c5-3-1-7-4(6)2-8-3/h1-2H2 | | InChIKey | RKDVKSZUMVYZHH-UHFFFAOYSA-N | | SMILES | O1CC(=O)OCC1=O | | CAS DataBase Reference | 502-97-6(CAS DataBase Reference) | | NIST Chemistry Reference | 1,4-Dioxane-2,5-dione(502-97-6) | | EPA Substance Registry System | 1,4-Dioxane-2,5-dione (502-97-6) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-36-22 | | Safety Statements | 22-24/25-37/39-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29322090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| Provider | Language |
|
ALFA
| English |
| | 1,4-Dioxane-2,5-dione Usage And Synthesis |
| Chemical Properties | mp 82-86°C 99.5+% | | Uses | 1,4-Dioxane-2,5-dione is used in the fabricating of artificial blood vessels. | | General Description | Glycolide is a cyclic dimer of α-hydroxy acid that can be used in the formation of aliphatic polyester. It is synthesized by the dimerization of glycolic acid. It forms a low toxic synthetic biodegradable polymer that can be used in medical applications. It is majorly used in the formation of a highly crystalline poly(glycolide) by ring opening polymerization. | | Flammability and Explosibility | Not classified | | Synthesis | Weigh 50g of ethanoic acid into a 500ml double-necked flask, then add 0.05g of phenylalanine stannous catalyst (0.1wt%), pre-polymerization at atmospheric pressure, 120 under the condition of 0.5h, and then increase the temperature to 160 , through the decompression distillation device for vacuum dewatering, the reaction of about 2h to no water discharge, you can get a white oligomer. Then 1,4-dioxane-2,5-hexanedione was collected by decompression cracking at 260C. 5h was completed and 33.9g of crude 1,4-dioxane-2,5-hexanedione was received, the product yield was 89%, and the melting point of the product was 90.6C. |
| | 1,4-Dioxane-2,5-dione Preparation Products And Raw materials |
|