|
|
| | Ytterbium(III) nitrate pentahydrate Basic information |
| | Ytterbium(III) nitrate pentahydrate Chemical Properties |
| form | Crystalline Aggregates | | color | White | | Sensitive | Hygroscopic | | Merck | 14,10105 | | InChI | InChI=1S/HNO3.H2O.Yb/c2-1(3)4;;/h(H,2,3,4);1H2; | | InChIKey | JWUHUUOSWOEQPT-UHFFFAOYSA-N | | SMILES | N(O)(=O)=O.O.[Yb] | | CAS DataBase Reference | 35725-34-9(CAS DataBase Reference) |
| Hazard Codes | O,Xi | | Risk Statements | 8-36/37/38 | | Safety Statements | 17-26-36 | | RIDADR | UN 1477 5.1/PG 2 | | WGK Germany | 3 | | HazardClass | 5.1 | | PackingGroup | III | | HS Code | 28469099 | | Storage Class | 5.1B - Oxidizing hazardous materials | | Hazard Classifications | Eye Irrit. 2
Ox. Sol. 2
Skin Irrit. 2
STOT SE 3 |
| | Ytterbium(III) nitrate pentahydrate Usage And Synthesis |
| Chemical Properties | Ytterbium nitrate pentahydrate is a white crystalline with hygroscopicity. Its relative density 2.98, burning decomposition for ytterbium oxide. Soluble in water. Ytterbium oxide dissolved in nitric acid, the solution is evaporated, crystallized and produced. | | Uses | Dysprosium trihydoxide has specialized uses in laser glass, phosphors, Dysprosium halide lamp and also as the main raw materials for making Dysprosium Metal. Dysprosium is one of the components of Terfenol-D,which is employed in transducers, wide-band mechanical resonators, and high-precision liquid-fuel injectors. | | reaction suitability | reagent type: catalyst
core: ytterbium |
| | Ytterbium(III) nitrate pentahydrate Preparation Products And Raw materials |
|