- Valpromide
-
- $30.00 / 50mg
-
2026-01-20
- CAS:2430-27-5
- Min. Order:
- Purity: 99.28%
- Supply Ability: 10g
- Valpromide
-
- $30.00 / 50mg
-
2026-01-20
- CAS:2430-27-5
- Min. Order:
- Purity: 99.28%
- Supply Ability: 10g
|
| | Valpromide Basic information |
| Product Name: | Valpromide | | Synonyms: | depamid;depamide;2-propyl-valeramid;alpha-propylvaleramide;Sodium Valproate Impurity 1;Valproic Acid Impurity 6(Valproic Acid EP Impurity F);Sodium Valproate EP Impurity F;Valproic Acid EP Impurity F | | CAS: | 2430-27-5 | | MF: | C8H17NO | | MW: | 143.23 | | EINECS: | 219-394-2 | | Product Categories: | API | | Mol File: | 2430-27-5.mol |  |
| | Valpromide Chemical Properties |
| Melting point | 123-125°C | | Boiling point | 261.35°C (rough estimate) | | density | 0.9636 (rough estimate) | | refractive index | 1.4614 (estimate) | | storage temp. | room temp | | solubility | DMSO: >10mg/mL | | pka | 16.76±0.50(Predicted) | | form | powder | | color | white to off-white | | Water Solubility | Soluble in chloroform, dimethyl sulfoxide and methanol. Insoluble in water. | | Merck | 14,9914 | | BRN | 1750444 | | InChI | InChI=1S/C8H17NO/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H2,9,10) | | InChIKey | OMOMUFTZPTXCHP-UHFFFAOYSA-N | | SMILES | C(N)(=O)C(CCC)CCC | | CAS DataBase Reference | 2430-27-5(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 22-36/37 | | WGK Germany | 3 | | RTECS | YV5965500 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ALFA
| English |
| | Valpromide Usage And Synthesis |
| Uses | Antiepileptic; anticonvulsant. | | Uses | Valpromide is a reactant used in the synthesis of mutual prodrugs containing bio-cleavable and drug releasable disulfide linkers. | | Definition | ChEBI: Valpromide is a fatty amide derived from valproic acid. It has a role as a metabolite, a teratogenic agent and a geroprotector. It is functionally related to a valproic acid. | | Biochem/physiol Actions | Valpromide (VPD) is a derivative of valproic acid (VPA) and is used as an antiepileptic drug. It is hydrolyzed quickly to VPA in vivo, but has intrinsic anticonvulsant activity. |
| | Valpromide Preparation Products And Raw materials |
|