|
|
| | 4-Amino-6-(trifluoromethyl)benzene-1,3-disulfonamide Basic information |
| | 4-Amino-6-(trifluoromethyl)benzene-1,3-disulfonamide Chemical Properties |
| Melting point | 241-246 °C | | Boiling point | 562.8±60.0 °C(Predicted) | | density | 1.743±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 9.14±0.60(Predicted) | | form | Solid | | color | White to Off-White | | BRN | 1164542 | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C7H8F3N3O4S2/c8-7(9,10)3-1-4(11)6(19(13,16)17)2-5(3)18(12,14)15/h1-2H,11H2,(H2,12,14,15)(H2,13,16,17) | | InChIKey | KRVABEGPNKGLOT-UHFFFAOYSA-N | | SMILES | C1(S(N)(=O)=O)=C(C(F)(F)F)C=C(N)C(S(N)(=O)=O)=C1 | | CAS DataBase Reference | 654-62-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2935909550 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Amino-6-(trifluoromethyl)benzene-1,3-disulfonamide Usage And Synthesis |
| Chemical Properties | Crystallizes. Melting point 242°C. | | Uses | 2,4-Disulfamyl-5-trifluoromethylaniline is a carbonic anhydrase inhibitor, used as a potential anti-tumor and antiglaucoma drug. Metabolite of hydroflumethazide, a diuretic. |
| | 4-Amino-6-(trifluoromethyl)benzene-1,3-disulfonamide Preparation Products And Raw materials |
|