|
|
| | Tris(2-methyl-1-aziridinyl)phosphine oxide Basic information |
| Product Name: | Tris(2-methyl-1-aziridinyl)phosphine oxide | | Synonyms: | 1,1’,1’’-phosphinylidynetris(2-methyl)azridine;1,1’,1’’-phosphinylidynetris(2-methyl-Aziridine;1,1’,1’’-phosphinylidynetris[2-methyl-aziridin;c3172;ent50,003;mapo;metapoxide;metepa | | CAS: | 57-39-6 | | MF: | C9H18N3OP | | MW: | 215.23 | | EINECS: | 200-326-5 | | Product Categories: | | | Mol File: | 57-39-6.mol |  |
| | Tris(2-methyl-1-aziridinyl)phosphine oxide Chemical Properties |
| Melting point | 25°C | | Boiling point | 90-92 °C (0.15-0.3 mmHg) | | density | 1.0790 | | form | liquid | | pka | 3.80±0.40(Predicted) | | Odor | amine odor | | InChI | InChI=1S/C9H18N3P/c1-7-4-10(7)13(11-5-8(11)2)12-6-9(12)3/h7-9H,4-6H2,1-3H3 | | InChIKey | DKKKIFBZPVPZMU-UHFFFAOYSA-N | | SMILES | P(N1CC1C)(N1CC1C)N1CC1C | | NIST Chemistry Reference | Tris(1-(2-methyl)aziridinyl)phosphine oxide(57-39-6) | | IARC | 3 (Vol. 9, Sup 7) 1987 | | EPA Substance Registry System | Metapa (57-39-6) |
| RIDADR | 2810 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | Toxicity | LD50 in male, female rats (mg/kg): 136, 213 orally (Gaines) |
| | Tris(2-methyl-1-aziridinyl)phosphine oxide Usage And Synthesis |
| Chemical Properties | Amber liquid; amine odor. Miscible with water and organic
solvents. | | Uses | Chemosterilant; in creaseproofing and flameproofing textiles. | | Uses | Metepa is a chemosterilant. | | Definition | ChEBI: Tris(2-methyl-1-aziridinyl)phosphine oxide is a phosphoramide. | | Hazard | Toxic by ingestion and skin absorption,
strong irritant to skin. | | Safety Profile | Poison by ingestion,
skin contact, intraperitoneal, and
subcutaneous routes. Experimental
teratogenic and reproductive effects.
Questionable carcinogen with experimental
carcinogenic data. Animal experiments
suggest cholinesterase inlubition, possibly
due to metabolic products of this material in
the body. When heated to decomposition it
emits very toxic fumes of NOx and POx. |
| | Tris(2-methyl-1-aziridinyl)phosphine oxide Preparation Products And Raw materials |
|