|
|
| | (2,3-DIMETHOXYBENZYL)METHYLAMINE Basic information |
| Product Name: | (2,3-DIMETHOXYBENZYL)METHYLAMINE | | Synonyms: | (2,3-DIMETHOXYBENZYL)METHYLAMINE;(2,3-Dimethoxybenzyl)methylamine95%;(2,3-DIMETHOXYBENZYL)METHYLAMINE 95%;(2,3-dimethoxybenzyl)methylamine hydrochloride;1-(2,3-dimethoxyphenyl)-N-methylmethanamine;methyl-o-veratryl-amine hydrochloride;(2,3-dimethoxyphenyl)methyl-methylammonium;Benzenemethanamine, 2,3-dimethoxy-N-methyl- | | CAS: | 53663-28-8 | | MF: | C10H15NO2 | | MW: | 181.23 | | EINECS: | | | Product Categories: | | | Mol File: | 53663-28-8.mol |  |
| | (2,3-DIMETHOXYBENZYL)METHYLAMINE Chemical Properties |
| storage temp. | 2-8°C | | form | solid | | InChI | InChI=1S/C10H15NO2/c1-11-7-8-5-4-6-9(12-2)10(8)13-3/h4-6,11H,7H2,1-3H3 | | InChIKey | UKKGAJSVGVCQAJ-UHFFFAOYSA-N | | SMILES | C1(CNC)=CC=CC(OC)=C1OC |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (2,3-DIMETHOXYBENZYL)METHYLAMINE Usage And Synthesis |
| | (2,3-DIMETHOXYBENZYL)METHYLAMINE Preparation Products And Raw materials |
|