|
|
| | 2,4-Dichloro-5-nitrophenol Basic information |
| Product Name: | 2,4-Dichloro-5-nitrophenol | | Synonyms: | 2,4-DICHLORO-5-NITROPHENOL;2,4-dichloro-5-nitrobenzenol;2,4-Dichloro-5-nitrophenol >Phenol, 2,4-dichloro-5-nitro-;2,4-Dichloro-5-nitropheno | | CAS: | 39489-77-5 | | MF: | C6H3Cl2NO3 | | MW: | 208 | | EINECS: | | | Product Categories: | | | Mol File: | 39489-77-5.mol |  |
| | 2,4-Dichloro-5-nitrophenol Chemical Properties |
| Melting point | 96-98°C | | Boiling point | 311.2±42.0 °C(Predicted) | | density | 1.682±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 6.09±0.24(Predicted) | | color | Light Tan | | BRN | 1733418 | | InChI | InChI=1S/C6H3Cl2NO3/c7-3-1-4(8)6(10)2-5(3)9(11)12/h1-2,10H | | InChIKey | OFAPWTOOMSVMIU-UHFFFAOYSA-N | | SMILES | C1(O)=CC([N+]([O-])=O)=C(Cl)C=C1Cl | | CAS DataBase Reference | 39489-77-5(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 2,4-Dichloro-5-nitrophenol Usage And Synthesis |
| Uses | 2,4-Dichloro-5-nitrophenol is an intermediate used to prepare (5-Substituted-pyrrolidinyl-2-carbonyl)-2-cyanopyrrolidines as Potent Dipeptidyl Peptidase IV Inhibitors. It is also used to synthesize cyanopyrrolo[2,3-d]pyrimidine derivatives as Hsp90 inhibitors. |
| | 2,4-Dichloro-5-nitrophenol Preparation Products And Raw materials |
|