- Cbz-L-Met-OH
-
-
2026-07-03
- CAS:1152-62-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- N-Cbz-L-methionine
-
-
2025-12-24
- CAS:1152-62-1
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 10 tons
- N-Cbz-L-methionine
-
- $1.00
-
2019-07-06
- CAS:1152-62-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | N-Cbz-L-methionine Basic information |
| | N-Cbz-L-methionine Chemical Properties |
| Melting point | 67-69 °C | | alpha | -18.5 º (c=2.4 in 95% EtOH) | | Boiling point | 504.7±50.0 °C(Predicted) | | density | 1.253±0.06 g/cm3(Predicted) | | refractive index | -26 ° (C=1, MeOH) | | storage temp. | 2-8°C | | solubility | almost transparency in Methanol | | form | Powder or Crystalline Powder | | pka | 3.81±0.10(Predicted) | | color | White to off-white | | Optical Rotation | [α]25/D 18.5°, c = 2.4 in 95% ethanol | | BRN | 2058696 | | Major Application | peptide synthesis | | InChI | 1S/C13H17NO4S/c1-19-8-7-11(12(15)16)14-13(17)18-9-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,14,17)(H,15,16)/t11-/m0/s1 | | InChIKey | FPKHNNQXKZMOJJ-LLVKDONJSA-N | | SMILES | CSCC[C@H](NC(=O)OCc1ccccc1)C(O)=O | | CAS DataBase Reference | 1152-62-1(CAS DataBase Reference) |
| | N-Cbz-L-methionine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | N-Cbz-L-methionine is a protected form of L-Methionine (M260440). L-Methionine is an essential amino acid that is obtained from our diet. L-Methionine can be found in grain legumes (such as lentils), and poultry. L-Methionine’s main function is to act as the primary “Start” sequence on mRNA so that the ribosomes can start translating the mRNA into proteins. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-Cbz-L-methionine Preparation Products And Raw materials |
|