|
|
| | FMOC-3-AMINOBENZOIC ACID Basic information |
| | FMOC-3-AMINOBENZOIC ACID Chemical Properties |
| Boiling point | 548.3±33.0 °C(Predicted) | | density | 1.352±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.13±0.10(Predicted) | | Appearance | White to off-white Solid | | BRN | 7226236 | | Major Application | peptide synthesis | | InChI | 1S/C22H17NO4/c24-21(25)14-6-5-7-15(12-14)23-22(26)27-13-20-18-10-3-1-8-16(18)17-9-2-4-11-19(17)20/h1-12,20H,13H2,(H,23,26)(H,24,25) | | InChIKey | VFXDSSUGFNVDJP-UHFFFAOYSA-N | | SMILES | OC(=O)c1cccc(NC(=O)OCC2c3ccccc3-c4ccccc24)c1 | | CAS DataBase Reference | 185116-42-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | FMOC-3-AMINOBENZOIC ACID Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Fmoc-3-aminobenzoic acid is used in the preparation of hydrogelators with multiple applications including; drug delivery carriers. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-3-AMINOBENZOIC ACID Preparation Products And Raw materials |
|