| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Equilin-d4 CAS:285979-79-5 Package:10Mg,1Mg
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Equilin-d4 CAS:285979-79-5 Remarks:CS-C-01414
|
| Company Name: |
ChemStrong Scientific Co.,Ltd
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
sales@chem-strong.com |
| Products Intro: |
Product Name:Equilin-d4 CAS:285979-79-5 Purity:95% HPLC Package:10mg;25mg;50mg
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Equilin-2,4,16,16-d4 CAS:285979-79-5 Purity:98 atom % D Package:100MG Remarks:492523-100MG
|
|
| | Equilin-d4 Basic information |
| Product Name: | Equilin-d4 | | Synonyms: | EQUILIN-2,4,16,16-D4;EQUILIN-2,4,16,16-D4, 98 ATOM % D;EQUILENIN-2,4,16,16-D4 97-98%;EQUILIN-2,4,16,16-D4 98%;Equilin-d4;1,3,5,7-Estratetraen-3-ol-17-one-d4;3-Hydroxyestra-1,3,5(10),7-tetraen-17-one-d4;7-Dehydroestrone-d4 | | CAS: | 285979-79-5 | | MF: | C18H16D4O2 | | MW: | 272.38 | | EINECS: | | | Product Categories: | Steroids & Hormones - 13C & 2H;Alphabetical Listings;E-F;Stable Isotopes;Intermediates & Fine Chemicals;Isotope Labelled Compounds;Pharmaceuticals;Steroids | | Mol File: | 285979-79-5.mol |  |
| | Equilin-d4 Chemical Properties |
| Melting point | 238-240 °C(lit.) | | storage temp. | Refrigerator | | solubility | Dioxane (Slightly, Heated, Sonicated), Methanol (Slightly, Heated, Sonicated) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]25/D 325°, c = 2 in ethanol | | InChI | 1S/C18H20O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3-5,10,14,16,19H,2,6-9H2,1H3/t14-,16+,18+/m1/s1/i3D,7D2,10D | | InChIKey | WKRLQDKEXYKHJB-DLIXUXMWSA-N | | SMILES | [2H]c1cc2[C@H]3CC[C@@]4(C)[C@@H](CC([2H])([2H])C4=O)C3=CCc2c([2H])c1O | | EPA Substance Registry System | Estra-1,3,5(10),7-tetraen-17-one-2,4,16,16-d4, 3-hydroxy- (285979-79-5) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-62-40-63 | | Safety Statements | 36-36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Carc. 2 Repr. 2 |
| | Equilin-d4 Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | As an estrogen found in Premarin, Equilin-d4 is a mixture of conjugated estrogens widely used in hormone replacement therapy. |
| | Equilin-d4 Preparation Products And Raw materials |
|