- 4'-Phenoxyacetophenone
-
- $0.00 / 25kg
-
2025-12-01
- CAS:5031-78-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- 4'-Phenoxyacetophenone
-
- $1.00 / 1KG
-
2020-01-08
- CAS:5031-78-7
- Min. Order: 1KG
- Purity: 98%HPLC
- Supply Ability: 10 tons/month
|
| | 4'-Phenoxyacetophenone Basic information |
| | 4'-Phenoxyacetophenone Chemical Properties |
| Melting point | 50-52 °C(lit.) | | Boiling point | 200 °C12 mm Hg(lit.) | | density | 1.1035 (rough estimate) | | refractive index | 1.5570 (estimate) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | Powder | | color | Light yellow | | Water Solubility | insoluble | | BRN | 2049295 | | InChI | 1S/C14H12O2/c1-11(15)12-7-9-14(10-8-12)16-13-5-3-2-4-6-13/h2-10H,1H3 | | InChIKey | DJNIFZYQFLFGDT-UHFFFAOYSA-N | | SMILES | CC(=O)c1ccc(Oc2ccccc2)cc1 | | CAS DataBase Reference | 5031-78-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29145090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4'-Phenoxyacetophenone Usage And Synthesis |
| Chemical Properties | light yellow powder |
| | 4'-Phenoxyacetophenone Preparation Products And Raw materials |
|