|
| 1-(4-METHOXYBENZYL)PIPERAZINE Basic information |
| 1-(4-METHOXYBENZYL)PIPERAZINE Chemical Properties |
Melting point | 32-36 °C (lit.) | Boiling point | 144 °C | density | 1.053±0.06 g/cm3(Predicted) | Fp | >230 °F | storage temp. | 2-8°C, protect from light | form | Solid | pka | 9.15±0.10(Predicted) | color | White to yellow | InChI | InChI=1S/C12H18N2O/c1-15-12-4-2-11(3-5-12)10-14-8-6-13-7-9-14/h2-5,13H,6-10H2,1H3 | InChIKey | MGLUVVBFISROAH-UHFFFAOYSA-N | SMILES | N1(CC2=CC=C(OC)C=C2)CCNCC1 | CAS DataBase Reference | 21867-69-6(CAS DataBase Reference) |
Hazard Codes | Xn,Xi | Risk Statements | 22 | Safety Statements | 26-36/37/39 | WGK Germany | 2 | HazardClass | IRRITANT |
| 1-(4-METHOXYBENZYL)PIPERAZINE Usage And Synthesis |
Uses | 1-(4-Methoxybenzyl)piperazine is used as a pharmaceutical intermediate. |
| 1-(4-METHOXYBENZYL)PIPERAZINE Preparation Products And Raw materials |
|