|
|
| | 1-(4-METHOXYBENZYL)PIPERAZINE Basic information |
| | 1-(4-METHOXYBENZYL)PIPERAZINE Chemical Properties |
| Melting point | 32-36 °C (lit.) | | Boiling point | 144 °C | | density | 1.053±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | 2-8°C, protect from light | | pka | 9.15±0.10(Predicted) | | form | Solid | | color | White to yellow | | InChI | InChI=1S/C12H18N2O/c1-15-12-4-2-11(3-5-12)10-14-8-6-13-7-9-14/h2-5,13H,6-10H2,1H3 | | InChIKey | MGLUVVBFISROAH-UHFFFAOYSA-N | | SMILES | N1(CC2=CC=C(OC)C=C2)CCNCC1 | | CAS DataBase Reference | 21867-69-6(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22 | | Safety Statements | 26-36/37/39 | | WGK Germany | 2 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-(4-METHOXYBENZYL)PIPERAZINE Usage And Synthesis |
| Uses | 1-(4-Methoxybenzyl)piperazine is used as a pharmaceutical intermediate. |
| | 1-(4-METHOXYBENZYL)PIPERAZINE Preparation Products And Raw materials |
|