|
|
| | Cloperastine hydrochloride Basic information |
| Product Name: | Cloperastine hydrochloride | | Synonyms: | 1-(2-((p-chloro-alpha-phenylbenzyl)oxy)ethyl)-piperidinhydrochloride;1-(2-(p-cloro-alpha-fenilbenzilossi)etil)piperidinacloridrato;2-piperidinoethylp-chlorobenzhydryletherhydrochloride;cloperastinacloridrato;ht11;hustazol;4-CHLOROBENZHYDRYL 2-[1-PIPERIDYL]-ETHYL ETHER HYDROCHLORIDE;CHLOPERASTINE HYDROCHLORIDE | | CAS: | 14984-68-0 | | MF: | C20H25Cl2NO | | MW: | 366.32 | | EINECS: | 239-067-8 | | Product Categories: | | | Mol File: | 14984-68-0.mol |  |
| | Cloperastine hydrochloride Chemical Properties |
| Melting point | 147.9° | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Merck | 14,2395 | | Major Application | forensics and toxicology
pharmaceutical (small molecule)
veterinary | | InChI | InChI=1S/C20H24ClNO.ClH/c21-19-11-9-18(10-12-19)20(17-7-3-1-4-8-17)23-16-15-22-13-5-2-6-14-22;/h1,3-4,7-12,20H,2,5-6,13-16H2;1H | | InChIKey | UNPLRYRWJLTVAE-UHFFFAOYSA-N | | SMILES | C(OCCN1CCCCC1)(C1C=CC=CC=1)C1=CC=C(Cl)C=C1.Cl | | CAS DataBase Reference | 14984-68-0(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | RTECS | TM6491500 | | HS Code | 2933.39.9200 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Cloperastine hydrochloride Usage And Synthesis |
| Uses | Antitussive;'Histamine antagonist | | Uses | Cloperastine Hydrochloride is an anti-tussive drug as an over-the-counter cold medicine. | | Definition | ChEBI: Cloperastine hydrochloride is a diarylmethane. | | in vivo | In the anesthetized guinea pigs, Cloperastine at a therapeutic dose of 1 mg/kg prolonged the QT interval and monophasic?
action potential (MAP) duration without affecting PR interval or QRS width[1].
?
Cloperastine hydrochloride shows relatively low acute toxicity when administered by the intraperitoneal route in rats and mice, and shows minor toxicity by the oral route when administered as Cloperastine fendizoate, the LD50 in rats and mice for the two administration routes exceeds 1000 and 2000 mg/kg, respectively[2]. |
| | Cloperastine hydrochloride Preparation Products And Raw materials |
|