|
|
| | 2,3-(METHYLENEDIOXY)BENZALDEHYDE Basic information |
| Product Name: | 2,3-(METHYLENEDIOXY)BENZALDEHYDE | | Synonyms: | TIMTEC-BB SBB004074;BUTTPARK 27\02-58;4-FORMYL-1,3-BENZODIOXOLE;1,3-BENZODIOXOLE-4-CARBOXALDEHYDE;1,3-BENZODIOXOLE-4-CARBALDEHYDE;2,3-(METHYLENEDIOXY)BENZALDEHYDE;benzo-1,3-dioxole-4-carboxaldehyde;2,3-(Methylenedioxy)benzaldehyde ,97% | | CAS: | 7797-83-3 | | MF: | C8H6O3 | | MW: | 150.13 | | EINECS: | 232-252-4 | | Product Categories: | | | Mol File: | 7797-83-3.mol |  |
| | 2,3-(METHYLENEDIOXY)BENZALDEHYDE Chemical Properties |
| Melting point | 34-36 °C(lit.) | | Boiling point | 80 °C0.3 mm Hg(lit.) | | density | 1.312 g/mL at 25 °C(lit.) | | refractive index | 1.4500 (estimate) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Solid | | color | White to Pale Yellow | | BRN | 125644 | | InChI | InChI=1S/C8H6O3/c9-4-6-2-1-3-7-8(6)11-5-10-7/h1-4H,5H2 | | InChIKey | QZMQKPGVXNSITP-UHFFFAOYSA-N | | SMILES | O1C2=CC=CC(C=O)=C2OC1 | | CAS DataBase Reference | 7797-83-3(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | DF4912450 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids | | Toxicity | TDLo orl-rat: 12.8 mg/kg BIPBU* 24,1277,2001 |
| | 2,3-(METHYLENEDIOXY)BENZALDEHYDE Usage And Synthesis |
| Chemical Properties | White to yellow solid | | Synthesis Reference(s) | Tetrahedron Letters, 32, p. 2461, 1991 DOI: 10.1016/S0040-4039(00)74353-X | | Hazard | A poison by ingestion. | | Safety Profile | A poison by ingestion. Whenheated to decomposition it emits acrid smoke andirritating vapors. |
| | 2,3-(METHYLENEDIOXY)BENZALDEHYDE Preparation Products And Raw materials |
|