|
|
| | 3-Indoxyl-beta-D-galactopyranoside Basic information |
| | 3-Indoxyl-beta-D-galactopyranoside Chemical Properties |
| storage temp. | 2-8°C | | form | powder | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C14H17NO6/c16-6-10-11(17)12(18)13(19)14(21-10)20-9-5-15-8-4-2-1-3-7(8)9/h1-5,10-19H,6H2/t10-,11+,12+,13-,14-/m1/s1 | | InChIKey | XVARCVCWNFACQC-MBJXGIAVSA-N | | SMILES | OC[C@H]1O[C@@H](Oc2c[nH]c3ccccc23)[C@H](O)[C@@H](O)[C@H]1O |
| Risk Statements | 67 | | Safety Statements | 24/25 | | RIDADR | UN 3175 4.1 / PGII | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Eye Irrit. 2 Flam. Sol. 2 |
| Provider | Language |
|
ACROS
| English |
| | 3-Indoxyl-beta-D-galactopyranoside Usage And Synthesis |
| Chemical Properties | white to off-white powder | | Uses | 3-Indolyl-β-D-galactopyranoside is used in microbiology culture media to identify lac+ organisms (e.g. general coliforms.) It is also used in histochemistry and in biochemistry. | | Uses | Indoxyl β-D-Galactopyranoside is a chromogenic substrate for Beta-galactosidase. |
| | 3-Indoxyl-beta-D-galactopyranoside Preparation Products And Raw materials |
|