|
|
| | 4,7-Difluoroindan-1-one Basic information |
| Product Name: | 4,7-Difluoroindan-1-one | | Synonyms: | 4,7-Difluoro-2,3-dihydro-1H-inden-1-one, 4,7-Difluoro-2,3-dihydro-1-oxo-1H-indene;4,7-Difluoro-1-indanone;4,7-difluoro-2,3-dihydroinden-1-one;1H-Inden-1-one, 4,7-difluoro-2,3-dihydro-;4,7-difluoro-1-indenone;4,7-Difluoro-2,3-dihydro-1H-inden-1-one;4,7-Difluoroindan-1-one | | CAS: | 130408-16-1 | | MF: | C9H6F2O | | MW: | 168.14 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 4,7-Difluoroindan-1-one Chemical Properties |
| Boiling point | 254.7±40.0 °C(Predicted) | | density | 1.362±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H6F2O/c10-6-2-3-7(11)9-5(6)1-4-8(9)12/h2-3H,1,4H2 | | InChIKey | KMWBFTTYYGUTNW-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C(F)=CC=C2F)CC1 |
| | 4,7-Difluoroindan-1-one Usage And Synthesis |
| | 4,7-Difluoroindan-1-one Preparation Products And Raw materials |
|