|
|
| | ETHYL ISOXAZOLE-3-CARBOXYLATE Basic information |
| Product Name: | ETHYL ISOXAZOLE-3-CARBOXYLATE | | Synonyms: | AKOS PAO-1389;ETHYL ISOXAZOLE-3-CARBOXYLATE;4-CHLOROISOINDOLINE HCL;isoxazole-3-carboxylic acid ethyl ester;3-Isoxazolecarboxylic acid ethyl ester;Methyl isoxazole-3-carboxylate;3-Ethoxycarbonylisoxazole;Ethyl 3-isoxazolecarboxylate | | CAS: | 3209-70-9 | | MF: | C6H7NO3 | | MW: | 141.12 | | EINECS: | | | Product Categories: | | | Mol File: | 3209-70-9.mol |  |
| | ETHYL ISOXAZOLE-3-CARBOXYLATE Chemical Properties |
| Boiling point | 219℃ | | density | 1.177 | | Fp | 87℃ | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | -5.43±0.50(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C6H7NO3/c1-2-9-6(8)5-3-4-10-7-5/h3-4H,2H2,1H3 | | InChIKey | RKXWKTOBQOSONL-UHFFFAOYSA-N | | SMILES | O1C=CC(C(OCC)=O)=N1 |
| | ETHYL ISOXAZOLE-3-CARBOXYLATE Usage And Synthesis |
| Uses | Ethyl Isoxazol-3-carboxylate has been used as a reactant in the preparation of demethyl 2-amino-3-(3-carboxy-5-methyl-4-isoxazolyl)propionic acid (ACPA) which shows activity at metabotropic receptors and is a weak antagonist at the mGlu2 receptor subtype. | | Synthesis Reference(s) | Canadian Journal of Chemistry, 48, p. 467, 1970 DOI: 10.1139/v70-075 |
| | ETHYL ISOXAZOLE-3-CARBOXYLATE Preparation Products And Raw materials |
|