- BOC-NLE-OH DCHA
-
- $2.00 / 1KG
-
2020-01-10
- CAS:21947-32-0
- Min. Order: 1g
- Purity: 98%MIN
- Supply Ability: ASK
|
| | BOC-NLE-OH DCHA Basic information |
| | BOC-NLE-OH DCHA Chemical Properties |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | Major Application | peptide synthesis | | InChI | 1S/C12H23N.C11H21NO4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-6-7-8(9(13)14)12-10(15)16-11(2,3)4/h11-13H,1-10H2;8H,5-7H2,1-4H3,(H,12,15)(H,13,14)/t;8-/m.0/s1 | | InChIKey | BFEVJIUEBDZIJQ-WDBKTSHHSA-N | | SMILES | [N+H2](C2CCCCC2)C1CCCCC1.N([C@@H](CCCC)C(=O)[O-])C(=O)OC(C)(C)C |
| WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | BOC-NLE-OH DCHA Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-NLE-OH DCHA Preparation Products And Raw materials |
|