ETHANOL-D6 manufacturers
- ETHANOL-D6
-
- $0.00 / 25KG
-
2025-12-01
- CAS:1516-08-1
- Min. Order: 1KG
- Purity: 98
- Supply Ability: 10000KGS
- ETHANOL-D6
-
- $1.50 / 1g
-
2025-04-29
- CAS:1516-08-1
- Min. Order: 1g
- Purity: 99.0% Min
- Supply Ability: 100 Tons
- ETHANOL-D6
-
- $1.50 / 1g
-
2025-04-18
- CAS:1516-08-1
- Min. Order: 1g
- Purity: 99.0% Min
- Supply Ability: 1 Ton
|
| | ETHANOL-D6 Basic information |
| | ETHANOL-D6 Chemical Properties |
| Melting point | -114,1°C | | Melting point | -130 °C(lit.) | | Boiling point | 78 °C(lit.) | | Boiling point | 78,5°C | | density | 0.892 g/mL at 25 °C | | density | d = 0,89 | | refractive index | n20/D 1.358(lit.) | | Fp | 48 °F | | storage temp. | Flammables area | | solubility | All Organic Solvents | | form | Liquid | | color | Colorless | | Specific Gravity | 0.91 | | explosive limit | 3.5-15%(V)(ethanol) | | Water Solubility | Soluble in water. | | Sensitive | Hygroscopic | | BRN | 1699096 | | Stability: | Volatile | | InChI | 1S/C2H6O/c1-2-3/h3H,2H2,1H3/i1D3,2D2,3D | | InChIKey | LFQSCWFLJHTTHZ-LIDOUZCJSA-N | | SMILES | [2H]OC([2H])([2H])C([2H])([2H])[2H] | | CAS DataBase Reference | 1516-08-1(CAS DataBase Reference) |
| Hazard Codes | F | | Risk Statements | 11 | | Safety Statements | 7-16-2017/7/16 | | RIDADR | UN 1170 3/PG 2 | | WGK Germany | 1 | | Autoignition Temperature | 425 °C (ethanol) | | HazardClass | 3 | | PackingGroup | II | | HS Code | 28459000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 | | Toxicity | LD50 orally in Rabbit: 6200 mg/kg |
| | ETHANOL-D6 Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Ethanol-d_6, is employed as an NMR solvent. It is used as pharmaceutical intermediate. | | Definition | ChEBI: Ethanol-d6 is a deuterated compound, a volatile organic compound, an alkyl alcohol and a member of ethanols. | | General Description | Ethanol-d6 is a deuterated derivative of ethanol. It has an isotopic purity of 99.5atom%D. It is a standard purity solvent suitable for routine NMR analyses (conducted at ambient temperatures where quality is less critical). |
| | ETHANOL-D6 Preparation Products And Raw materials |
|