Gatifloxacin sesquihydrate manufacturers
|
| | Gatifloxacin sesquihydrate Basic information |
| Product Name: | Gatifloxacin sesquihydrate | | Synonyms: | Gatifloxacin formic acid ethyl ester;Gatifloxacin (300 mg);Gatifloxacin Monohydrate;Gatifloxcin 1-cyclopropyl-6-fluoro-1,4-dihydro-8-Methoxy-7-(3-Methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid;3-Quinolinecarboxylic acid, 1-cyclopropyl-6-fluoro-1,4-dihydro-8-Methoxy-7-(3-Methyl-1-piperazinyl)-4-oxo-, hydrate (2:3);(+-)-1-C;1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid;1-Cyclopropyl-6-fluoro-8-Methoxy-7-(3-Methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid sesquihydrate | | CAS: | 180200-66-2 | | MF: | C19H24FN3O5 | | MW: | 393.42 | | EINECS: | 672-577-2 | | Product Categories: | Active Pharmaceutical Ingredients;APIs | | Mol File: | 180200-66-2.mol |  |
| | Gatifloxacin sesquihydrate Chemical Properties |
| Boiling point | 684℃ | | RTECS | VB1983600 | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | Soluble in 1N NaOH at 10mg/ml | | form | powder | | color | white to beige | | BRN | 14390028 | | InChI | InChI=1S/C19H22FN3O4.H2O/c1-10-8-22(6-5-21-10)16-14(20)7-12-15(18(16)27-2)23(11-3-4-11)9-13(17(12)24)19(25)26;/h7,9-11,21H,3-6,8H2,1-2H3,(H,25,26);1H2 | | InChIKey | IJOOSVJZBQQMBV-UHFFFAOYSA-N | | SMILES | O(C1C(N2CCNC(C)C2)=C(F)C=C2C(=O)C(C(=O)O)=CN(C3CC3)C=12)C.O |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36/37 | | WGK Germany | 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| | Gatifloxacin sesquihydrate Usage And Synthesis |
| Uses | Antibacterial. | | Uses | A broad spectrum antibiotic | | Brand name | Tequin (Bristol-Myers Squibb); Zymar (Allergan). | | Biological Activity | Gatifloxacin sesquihydrateis an oral fluoroquinolone broad spectrum antibiotic, inhibitor of bacterial enzymes DNA gyrase and topoisomerase IV, with improved gram-positive and anaerobe coverage. Gatifloxacin is reported to be useful to tre at ocular infection and does not appear to cause phototoxic effects. |
| | Gatifloxacin sesquihydrate Preparation Products And Raw materials |
|