METHYL 3-BUTENOATE manufacturers
- METHYL 3-BUTENOATE
-
-
2026-05-14
- CAS:3724-55-8
- Min. Order: 1kg
- Purity: 97
- Supply Ability: 1 ton/month
- METHYL 3-BUTENOATE
-
- $1.00
-
2024-07-12
- CAS:3724-55-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
|
| | METHYL 3-BUTENOATE Basic information |
| Product Name: | METHYL 3-BUTENOATE | | Synonyms: | 3-butenoicacid,methylester;CH2=CHCH2C(O)OCH3;METHYL VINYLACETATE;METHYL 3-BUTENOATE;Methyl 3-butenoate 95%;Methyl but-3-enoate,98% (stabilized with MEHQ);but-3-enoic acid methyl ester;methyl but-3-enoate | | CAS: | 3724-55-8 | | MF: | C5H8O2 | | MW: | 100.12 | | EINECS: | 223-076-9 | | Product Categories: | | | Mol File: | 3724-55-8.mol |  |
| | METHYL 3-BUTENOATE Chemical Properties |
| Melting point | -78.42°C (estimate) | | Boiling point | 112 °C (lit.) | | density | 0.939 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.409(lit.) | | Fp | 60 °F | | storage temp. | Storage temp. 2-8°C | | form | liquid | | Appearance | Colorless to light yellow Liquid | | BRN | 1741732 | | InChI | InChI=1S/C5H8O2/c1-3-4-5(6)7-2/h3H,1,4H2,2H3 | | InChIKey | GITITJADGZYSRL-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CC=C | | LogP | 0.839 (est) | | NIST Chemistry Reference | Methyl 3-butenoate(3724-55-8) | | EPA Substance Registry System | 3-Butenoic acid, methyl ester (3724-55-8) |
| Hazard Codes | F | | Risk Statements | 11 | | Safety Statements | 16 | | RIDADR | UN 3272 3/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 3.1 | | PackingGroup | II | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 |
| | METHYL 3-BUTENOATE Usage And Synthesis |
| Uses | Methyl 3-butenoate may be employed for the synthesis of dipeptide olefin isosteres using intermolecular olefin cross-metathesis. | | Synthesis Reference(s) | Journal of the American Chemical Society, 99, p. 5184, 1977 DOI: 10.1021/ja00457a052 Tetrahedron Letters, 14, p. 2433, 1973 DOI: 10.1016/S0040-4039(01)96239-2 | | General Description | Methyl 3-butenoate is an olefin ester. It is reported to undergo Iron carbonyl-promoted isomerization to afford α, β-unsaturated esters. It is one of the reaction products formed during flash vacuum thermolysis of ()-cocaine. The H2 and CH4 chemical ionization mass spectra of methyl 3-butenoate has been reported. |
| | METHYL 3-BUTENOATE Preparation Products And Raw materials |
|