- 4,5-DIPHENYLIMIDAZOLE
-
- $15.00 / 1KG
-
2021-07-02
- CAS:668-94-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- 4,5-DIPHENYLIMIDAZOLE
-
- $1.00 / 1kg
-
2019-07-06
- CAS:668-94-0
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 200kg
|
| | 4,5-DIPHENYLIMIDAZOLE Basic information |
| | 4,5-DIPHENYLIMIDAZOLE Chemical Properties |
| Melting point | 228-230 °C(lit.) | | Boiling point | 351.21°C (rough estimate) | | density | 1.149 | | refractive index | 1.5000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in methanol. | | form | powder to crystal | | pka | 12.99±0.10(Predicted) | | color | White to Almost white | | BRN | 157587 | | InChI | 1S/C15H12N2/c1-3-7-12(8-4-1)14-15(17-11-16-14)13-9-5-2-6-10-13/h1-11H,(H,16,17) | | InChIKey | CPHGOBGXZQKCKI-UHFFFAOYSA-N | | SMILES | c1ccc(cc1)-c2nc[nH]c2-c3ccccc3 | | CAS DataBase Reference | 668-94-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29332990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4,5-DIPHENYLIMIDAZOLE Usage And Synthesis |
| Chemical Properties | light beige fine crystalline powder | | Uses | 4,5-Diphenylimidazole is used as a precursor for azo dyes such as 2-(quinolylazo)-4,5-diphenylimidazole . It is also used to determine metal ions by spectrophotometrically. It acts as a chromogenic reagent. |
| | 4,5-DIPHENYLIMIDAZOLE Preparation Products And Raw materials |
|