METHYL-D-GLUCOPYRANOSIDE manufacturers
|
| | METHYL-D-GLUCOPYRANOSIDE Basic information |
| Product Name: | METHYL-D-GLUCOPYRANOSIDE | | Synonyms: | METHYL-D-GLUCOPYRANOSIDE;1-O-Methyl-D-glucopyranose;(2R,3S,4S,5R)-2-(Hydroxymethyl)-6-methoxytetrahydro-2H-pyran-3,4,5-triol;Methyl 5-O-trityl-a-D-glucopyranoside;Methyl-D-glucopyranoside-3149-68-6 | | CAS: | 3149-68-6 | | MF: | C7H14O6 | | MW: | 194.18 | | EINECS: | 221-581-9 | | Product Categories: | | | Mol File: | 3149-68-6.mol |  |
| | METHYL-D-GLUCOPYRANOSIDE Chemical Properties |
| Melting point | 155-165°C | | Boiling point | 389.1±42.0 °C(Predicted) | | density | 1.47±0.1 g/cm3(Predicted) | | bulk density | 400kg/m3 | | storage temp. | 2-30°C | | solubility | 600 g/L | | form | powder | | pka | 12.92±0.70(Predicted) | | Water Solubility | 600g/L | | InChI | 1S/C7H14O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-11H,2H2,1H3/t3,4-,5+,6-,7-/m0/s1 | | InChIKey | HOVAGTYPODGVJG-JXUVCOMLSA-N | | SMILES | O1[C@@H]([C@H]([C@@H]([C@H](C1CO)O)O)O)OC | | EPA Substance Registry System | D-Glucopyranoside, methyl (3149-68-6) |
| WGK Germany | WGK 1 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | METHYL-D-GLUCOPYRANOSIDE Usage And Synthesis |
| Uses | Methyl D-Glucopyranoside was studied for its possibility to be used as drilling fluids due to it being more environmentally friendly. | | Definition | ChEBI: Methyl D-glucoside is a methyl glucoside. |
| | METHYL-D-GLUCOPYRANOSIDE Preparation Products And Raw materials |
|