N,N-DIMETHYL-2-NITROANILINE manufacturers
|
| | N,N-DIMETHYL-2-NITROANILINE Basic information |
| | N,N-DIMETHYL-2-NITROANILINE Chemical Properties |
| Melting point | 57-58℃ | | Boiling point | 258℃ | | density | 1.193 | | refractive index | 1.6102 | | Fp | 110℃ | | storage temp. | 2-8°C | | pka | 2.68±0.18(Predicted) | | Appearance | Yellow to orange Liquid | | InChI | InChI=1S/C8H10N2O2/c1-9(2)7-5-3-4-6-8(7)10(11)12/h3-6H,1-2H3 | | InChIKey | NPZDNLCYFLDJFA-UHFFFAOYSA-N | | SMILES | C1(N(C)C)=CC=CC=C1[N+]([O-])=O | | EPA Substance Registry System | Benzenamine, N,N-dimethyl-2-nitro- (610-17-3) |
| Hazard Codes | Xi | | HS Code | 2921420090 |
| | N,N-DIMETHYL-2-NITROANILINE Usage And Synthesis |
| Uses | N,N-Dimethyl-2-nitroaniline (cas# 610-17-3) is a compound useful in organic synthesis. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 50, p. 1927, 1985 DOI: 10.1021/jo00211a028 |
| | N,N-DIMETHYL-2-NITROANILINE Preparation Products And Raw materials |
|