- 1-Naphthol-4-sulfonic acid
-
- $0.00 / 1kg
-
2025-12-29
- CAS:84-87-7
- Min. Order: 1kg
- Purity: 70%
- Supply Ability: According to customer requirements
|
| | 1-Naphthol-4-sulfonic acid Basic information |
| Product Name: | 1-Naphthol-4-sulfonic acid | | Synonyms: | 1-Naphthalenesulfonicacid,4-hydroxy-;4-hydroxy-1-naphthalenesulfonicaci;4-hydroxynaphthalene-1-sulphonicacid;Nevileandwinther’sacid;N-(M-SULFOPHENYL) GAMMA ACID;4-Hydroxy-1-naphthalenesulfonic acid;1-NAPHTHOL-4-SULFONIC ACID;Nevile-Winthers acid | | CAS: | 84-87-7 | | MF: | C10H8O4S | | MW: | 224.23 | | EINECS: | 201-568-4 | | Product Categories: | Intermediates of Dyes and Pigments | | Mol File: | 84-87-7.mol |  |
| | 1-Naphthol-4-sulfonic acid Chemical Properties |
| Melting point | 170℃ | | Boiling point | 335.63°C (rough estimate) | | density | 1.4643 (rough estimate) | | refractive index | 1.7040 (estimate) | | storage temp. | 2-8°C, stored under nitrogen, away from moisture | | pka | 0.73±0.40(Predicted) | | form | solid | | form | solid | | color | white to yellow | | InChI | InChI=1S/C10H8O4S/c11-9-5-6-10(15(12,13)14)8-4-2-1-3-7(8)9/h1-6,11H,(H,12,13,14) | | InChIKey | HGWQOFDAUWCQDA-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=C2C(C=CC=C2)=C(O)C=C1 | | CAS DataBase Reference | 84-87-7(CAS DataBase Reference) | | EPA Substance Registry System | 1-Naphthalenesulfonic acid, 4-hydroxy- (84-87-7) |
| | 1-Naphthol-4-sulfonic acid Usage And Synthesis |
| Chemical Properties | Transparent flake crystal. soluble in water. 1-Hydroxynaphthalene- 4 -sulfonic acid [84-87-7]. (4-hydroxynaphthalene-1-sulfonic acid), Nevile and Winther’s acid, NW acid, C10H8O4S, Mr 224.23, and its salts are water soluble, but the sodium salt may be precipitated from solution by salting out. Coupling with diazo compounds takes place in the 2-position. Nitration yields 2,4-dinitro-1-naphthol, whereas nitrosation gives 2-nitroso-1-hydroxynaphthalene-4-sulfonic acid. Sulfonation leads to a mixture of 1-hydroxynaphthalene-2,4-di- and 2,4,7- trisulfonic acids. | | Uses | 1-Naphthol-4-sulfonic acid is used as an intermediate of azo dyes to prepare dyes such as direct copper blue BR and 2R, direct violet RB, acid red B and acid medium jujube red B | | Preparation | After drying under vacuum, the resulting filter cake contains 1-naphthol-4-sulphonic acid in a yield of 92% of theory and <0.5% 1-naphthol-2-sulphonic acid and 3% of 1-naphthol-2,4-disulphonic acid based on the weight of 1-naphthol-4-sulphonic acid.

| | Synthesis | 1-Naphthol-4-sulfonic acid was synthesized by addition, hydrolysis and acid precipitation of sodium 1,4-aminonaphthalene sulfonate. |
| | 1-Naphthol-4-sulfonic acid Preparation Products And Raw materials |
| Raw materials | Sodium bisulfite-->Naphthionic acid | | Preparation Products | disodium 3-[[4'-[(6-amino-1-hydroxy-3-sulphonato-2-naphthyl)azo]-3,3'-dimethoxy[1,1'-biphenyl]-4-yl]azo]-4-hydroxynaphthalene-1-sulphonate-->C.I. 14720-->Direct Blue 151-->disodium 3-[[4'-[[6-amino-1-hydroxy-3-sulphonato-2-naphthyl]azo]-3,3'-dimethoxy[1,1'-biphenyl]-4-yl]azo]-4-hydroxynaphthalene-1-sulphonate-->sodium 3-[[4-(benzoylethylamino)-2-methylphenyl]azo]-4-hydroxynaphthalene-1-sulphonate-->sodium 4-hydroxy-3-[[3-(phenylsulphamoyl)-p-tolyl]azo]naphthalenesulphonate-->3-[(5-Chloro-2-hydroxy-3-sulfophenyl)azo]-4-hydroxy-1-naphthalenesulfonic acid disodium salt-->5-Amino-4-hydroxy-3-[[4'-[(1-hydroxy-4-sulfonaphthalen-2-yl)azo]-3,3'-dimethyl[1,1'-biphenyl]-4-yl]azo]-2,7-naphthalenedisulfonic acid trisodium salt-->Acid Red 374-->4,4'-[(2-Methyl-5-sodiosulfo-1,3-phenylene)bis[azo(4,6-diamino-3,1-phenylene)azo]]bis[naphthalene-1-sulfonic acid sodium] salt-->BENZOAZURINE-->BRILLIANT PURPURIN R-->THIAZINE RED-->Acid Violet 131-->NAPHTHALENE SCARLET B-->Aluminium, 7-hydroxy-8-[(4-sulfo-1-naphthalenyl)azo]-1,3-naphthalenedisulfonic acid complex-->Mordant Violet 2-->DIRECTVIOLET32-->disodium (3Z)-3-[[4-(4-anilino-3-sulfonato-phenyl)diazenylnaphthalen-1-yl]hydrazinylidene]-4-oxo-naphthalene-1-sulfonate-->3-[[2-[(N-Ethyl-N-phenylamino)sulfonyl]phenyl]azo]-4-hydroxy-1-naphthalenesulfonic acid sodium salt-->6-Amino-4-hydroxy-5-[[4'-[(1-hydroxy-4-sodiosulfo-2-naphthalenyl)azo]-1,1'-biphenyl-4-yl]azo]naphthalene-2-sulfonic acid sodium salt-->OXAMINE BLUE 4R |
|