2,2'-DIHYDROXYBENZOPHENONE manufacturers
|
| | 2,2'-DIHYDROXYBENZOPHENONE Basic information |
| | 2,2'-DIHYDROXYBENZOPHENONE Chemical Properties |
| Melting point | 61-62.5 °C(lit.) | | Boiling point | 333°C (estimate) | | density | 1.1956 (rough estimate) | | refractive index | 1.5090 (estimate) | | storage temp. | RT, stored under nitrogen | | solubility | almost transparency in Methanol | | pka | 7.32±0.30(Predicted) | | form | powder to crystal | | color | Light yellow to Yellow to Green | | InChI | InChI=1S/C13H10O3/c14-11-7-3-1-5-9(11)13(16)10-6-2-4-8-12(10)15/h1-8,14-15H | | InChIKey | YIYBRXKMQFDHSM-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1O)(C1=CC=CC=C1O)=O | | CAS DataBase Reference | 835-11-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 2914.50.3000 |
| | 2,2'-DIHYDROXYBENZOPHENONE Usage And Synthesis |
| Preparation | Preparation by diazotization of 4,4′-diamino-2,2′- di-hydroxybenzophenone in diluted hydrochloric acid, followed by treatment with 50% phosphorous acid at 0° for 1 h, then at r.t. for 24 h (34%). | | Definition | ChEBI: 2,2'-Dihydroxybenzophenone is a member of benzophenones. |
| | 2,2'-DIHYDROXYBENZOPHENONE Preparation Products And Raw materials |
|