|
|
| | 2'-Methylacetoacetanilide Basic information |
| | 2'-Methylacetoacetanilide Chemical Properties |
| Melting point | 104-106 °C(lit.) | | Boiling point | 326.97°C (rough estimate) | | density | 1.06 | | vapor pressure | 0.01 hPa ( 20 °C) | | refractive index | 1.5220 (estimate) | | Fp | 143°C | | storage temp. | Sealed in dry,Room Temperature | | pka | 11.22±0.46(Predicted) | | form | powder to crystal | | color | Crystals | | BRN | 2099098 | | InChI | 1S/C11H13NO2/c1-8-5-3-4-6-10(8)12-11(14)7-9(2)13/h3-6H,7H2,1-2H3,(H,12,14) | | InChIKey | TVZIWRMELPWPPR-UHFFFAOYSA-N | | SMILES | N(c1c(cccc1)C)C(=O)CC(=O)C | | LogP | 0.9 at 23℃ | | CAS DataBase Reference | 93-68-5(CAS DataBase Reference) | | NIST Chemistry Reference | Butanamide, n-(2-methylphenyl)-3-oxo-(93-68-5) | | EPA Substance Registry System | Butanamide, N-(2-methylphenyl)-3-oxo- (93-68-5) |
| Hazard Codes | Xn | | Risk Statements | 22-20/21/22 | | Safety Statements | 36-36/37-24/25 | | WGK Germany | 1 | | RTECS | AK6550000 | | TSCA | TSCA listed | | HS Code | 29242990 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral | | Toxicity | LD50 orl-rat: 1600 mg/kg KODAK* -,N-229,76 |
| | 2'-Methylacetoacetanilide Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | 2'-Methylacetoacetanilide is used as intermediate for the manufacture of organic pigments as well as for the manufacture of agrochemicals. | | Safety Profile | Moderately toxic by ingestion. When heated to decomposition it emits toxic fumes of NOx,. |
| | 2'-Methylacetoacetanilide Preparation Products And Raw materials |
|