|
|
| | rac-Ibuprofen amide Basic information |
| | rac-Ibuprofen amide Chemical Properties |
| Melting point | 110-114 | | Boiling point | 356.1±21.0 °C(Predicted) | | density | 0.994±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 16.23±0.50(Predicted) | | color | White | | BRN | 2448195 | | Major Application | pharmaceutical small molecule | | InChI | 1S/C13H19NO/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H2,14,15) | | InChIKey | REUQKCDCQVNKLW-UHFFFAOYSA-N | | SMILES | CC(C(N)=O)C1=CC=C(CC(C)C)C=C1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2924190090 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | rac-Ibuprofen amide Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | An impurity of Ibuprofen (I140000). |
| | rac-Ibuprofen amide Preparation Products And Raw materials |
|