|
|
| | 2,4-Difluorobenzonitrile Basic information |
| Product Name: | 2,4-Difluorobenzonitrile | | Synonyms: | 2,4-DIFLUOROBENZONITRILE;2,4-difluorobenzotrile;2,4-Difluorobenzonitrile,98%;2,4-difluorobenzonilyile;2-difluorobenzotrile;2,4-Difluorobenzonitrile 98%;2,4-Difluorobenzenecarbonitrile;2,4-DIFLUOROBENZONITRILE 97+% | | CAS: | 3939-09-1 | | MF: | C7H3F2N | | MW: | 139.1 | | EINECS: | 223-523-8 | | Product Categories: | Aromatic Nitriles;Nitrile;Boron, Nitrile, Thio,& TM-Cpds;Fluorobenzene Series;Fluorine Compounds;Nitriles;C6 to C7;Cyanides/Nitriles;Nitrogen Compounds;OLED | | Mol File: | 3939-09-1.mol |  |
| | 2,4-Difluorobenzonitrile Chemical Properties |
| Melting point | 47-49 °C (lit.) | | Boiling point | 189°C | | density | 1.246 | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Crystalline | | color | White to Almost white | | BRN | 1940316 | | InChI | InChI=1S/C7H3F2N/c8-6-2-1-5(4-10)7(9)3-6/h1-3H | | InChIKey | LJFDXXUKKMEQKE-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(F)C=C1F | | CAS DataBase Reference | 3939-09-1(CAS DataBase Reference) |
| Hazard Codes | Xn,T,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39-36/37/39-36/37 | | RIDADR | UN3439 | | WGK Germany | 3 | | Hazard Note | Toxic | | HazardClass | 6.1 | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,4-Difluorobenzonitrile Usage And Synthesis |
| Chemical Properties | white crystalline solid | | Uses | 2,4-Difluorobenzonitrile has been used in the synthesis of:
- 2-methylsulfonyl-4-fluorobenzylamine
- fluoro-3-amino-1,2-benzisoxazoles
| | General Description | 2,4-Difluorobenzonitrile undergoes polycondensation with Bisphenol A and matrix-assisted laser desorption/time-of-flight mass spectra revealed a quantitative formation of cyclic oligoethers and polyethers. | | Synthesis | General procedure for the synthesis of 2,4-difluorobenzonitrile from 2,4-difluorobenzamide: In a 250 mL three-necked flask, 2,4-difluorobenzamide (23.0 g, 146.2 mmol) was dissolved in dry N,N-dimethylformamide (80 mL), and cooled to -15°C. The reaction was continued for 0.5 h at room temperature. Phosphorus oxychloride (112.1 g, 730.9 mmol) was slowly added dropwise and the reaction was kept for 0.5 h. The reaction was then continued for 7 h at room temperature. Upon completion of the reaction, the reaction solution was slowly poured into a vessel containing ice to induce precipitation of solids. Finally, 17.0 g of 2,4-difluorobenzonitrile was obtained in 83.4% yield. | | References | [1] Patent: CN106854165, 2017, A. Location in patent: Paragraph 0104; 0105; 0136; 0137 |
| | 2,4-Difluorobenzonitrile Preparation Products And Raw materials |
|